
Catalog Number	AR003PPI
Chemical Name	DMAT
CAS Number	749234-11-5
Molecular Formula	C9H7Br4N3
Molecular Weight	476.7880
MDL Number	MFCD08705322
SMILES	CN(c1[nH]c2c(n1)c(Br)c(c(c2Br)Br)Br)C

4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzo[d]imidazol-2-amine is a versatile chemical compound that finds wide application in chemical synthesis processes. This compound serves as a valuable building block in the creation of various organic compounds due to its unique structure and reactivity. In chemical synthesis, this compound can act as a key intermediate in the preparation of complex molecules such as pharmaceuticals, agrochemicals, and materials. Its bromine atoms provide sites for further derivatization, allowing for the introduction of different functional groups to tailor the properties of the final product. Additionally, the dimethylamine group enhances the compound's solubility and can participate in a range of reactions to facilitate the formation of desired chemical bonds. Overall, 4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzo[d]imidazol-2-amine plays a crucial role in the synthesis of diverse organic compounds with potential applications in various industries.