
Catalog Number	AR00FC81
Chemical Name	VER-50589
CAS Number	747413-08-7
Molecular Formula	C19H17ClN2O5
Molecular Weight	388.8017
MDL Number	MFCD18382095
SMILES	CCNC(=O)C1=C(c2ccc(cc2)OC)/C(=C/2C=C(Cl)C(=CC2=O)O)/ON1

Ver-50589 is a versatile reagent widely used in chemical synthesis for its ability to facilitate a variety of reactions and transformations. This compound is particularly valued for its role in asymmetric synthesis, where it serves as a key catalyst in promoting the formation of chiral molecules with high levels of enantioselectivity. Moreover, Ver-50589 has shown great efficacy in promoting carbon-carbon bond formation and functional group interconversion reactions, making it a valuable tool for organic chemists seeking to streamline their synthetic routes and achieve complex molecular structures efficiently. Its robust performance and wide applicability make Ver-50589 an indispensable asset in modern synthetic chemistry.