
Catalog Number	AR005IMJ
Chemical Name	3-(2,4,6-TRIMETHOXYPHENYL)PROPANOIC ACID
CAS Number	74737-05-6
Molecular Formula	C12H16O5
Molecular Weight	240.2524
MDL Number	MFCD00045944
SMILES	COc1cc(OC)cc(c1CCC(=O)O)OC

2,4,6-Trimethoxybenzenepropanoic acid is a versatile compound widely utilized in chemical synthesis. With its unique structure, this organic acid serves as a key building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. In particular, it is commonly employed as a precursor in the synthesis of novel drugs and bioactive molecules due to its ability to undergo various chemical transformations. Its presence in the synthesis process imparts specific functional groups and characteristics that are essential for the desired properties of the final products. Additionally, 2,4,6-Trimethoxybenzenepropanoic acid plays a crucial role in the development of new materials and compounds with tailored properties, making it an indispensable component in the field of chemical research and development.