
Catalog Number	AR003F1O
Chemical Name	1H,1H,2H,2H-Perfluorodecyldimethylchlorosilane
CAS Number	74612-30-9
Molecular Formula	C12H10ClF17Si
Molecular Weight	540.7192
MDL Number	MFCD00042343
SMILES	C[Si](CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(Cl)C

1H,1H,2H,2H-Perfluorodecyldimethylchlorosilane, tech. 90% is a highly specialized compound used in chemical synthesis processes. With its unique molecular structure and properties, this silane derivative serves as a crucial reagent in a wide range of chemical reactions. Its perfluorinated alkyl chain confers exceptional hydrophobic and oleophobic characteristics, making it invaluable in creating non-stick surfaces, coatings, and materials resistant to water and oil. In chemical synthesis, this compound acts as a versatile building block for the modification of surfaces, polymers, and organic molecules, allowing for precise control over surface properties and functionalities. Its chlorosilane group is particularly reactive, enabling selective functionalization of substrates and facilitating the synthesis of complex organic compounds. By incorporating 1H,1H,2H,2H-Perfluorodecyldimethylchlorosilane, tech. 90% into their processes, chemists can enhance the efficiency and effectiveness of various synthesis pathways, ultimately leading to the development of novel and advanced materials with tailored properties and performance characteristics.