
Catalog Number	AR00FIIO
Chemical Name	8-Nitroquinolin-2(1H)-one
CAS Number	7461-12-3
Molecular Formula	C9H6N2O3
Molecular Weight	190.1555
MDL Number	MFCD21605405
SMILES	O=C1CC=c2c(=N1)c(ccc2)[N+](=O)[O-]

The chemical 8-Nitro-2(1H)-quinolinone is a versatile compound commonly used in chemical synthesis processes. It serves as a key building block for the production of various organic compounds due to its unique structural properties and reaction capabilities. In chemical synthesis, 8-Nitro-2(1H)-quinolinone can be utilized as a precursor for the creation of diverse functionalized molecules. Its nitro group can undergo reduction reactions to form amines, which are valuable intermediates in the pharmaceutical and agrochemical industries. Additionally, the quinolinone ring system can be further functionalized to introduce different functional groups, allowing for the synthesis of complex organic molecules with specific chemical properties. This compound plays a crucial role in the development of novel materials, pharmaceuticals, and other fine chemicals through its participation in various synthetic pathways.