
Catalog Number	AR00ID73
Chemical Name	Methyl (2S)-2-amino-5-(carbamoylamino)pentanoate
CAS Number	742655-88-5
Molecular Formula	C7H15N3O3
Molecular Weight	189.2123
MDL Number	MFCD27578185
SMILES	COC(=O)[C@H](CCCNC(=O)N)N

Methyl (2S)-2-amino-5-(carbamoylamino)pentanoate finds significant utility in chemical synthesis as a versatile building block. This compound acts as a valuable intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its amino and carbamoylamino functionalities make it a valuable precursor in the development of novel compounds through organic reactions such as amidation, esterification, and substitution reactions. Additionally, the chiral center in the molecule imparts stereochemical control in asymmetric synthesis, enabling the creation of enantiomerically pure compounds with defined stereochemistry.