
Catalog Number	AR005NK6
Chemical Name	Bis(4-(diphenylsulfonio)phenyl)sulfide bis(hexafluorophosphate)
CAS Number	74227-35-3
Molecular Formula	C36H28F12P2S3
Molecular Weight	846.7309
MDL Number	MFCD03427287
SMILES	c1ccc(cc1)[S+](c1ccccc1)c1ccc(cc1)Sc1ccc(cc1)[S+](c1ccccc1)c1ccccc1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F

Bis[4-(diphenylsulfonio)phenyl] sulfide bis(hexafluorophosphate) is a versatile compound frequently employed in chemical synthesis processes. This innovative chemical reagent finds wide utility as a powerful electrophilic sulfenylating agent in various synthetic reactions. Its unique structure and properties make it an excellent choice for the introduction of sulfide functionalities into diverse organic molecules. The compound's ability to facilitate sulfide bond formation under mild reaction conditions makes it particularly valuable in the synthesis of biologically active compounds, agrochemicals, and materials science applications. Its high reactivity and selectivity in sulfide coupling reactions make it a preferred reagent for challenging transformations in modern synthetic chemistry. This compound plays a crucial role in the construction of complex organic frameworks, enabling chemists to access novel chemical structures and develop innovative strategies in the field of chemical synthesis.