
Catalog Number	AR00FETB
Chemical Name	2-Acetylpyridine-4-boronic acid pinacol ester
CAS Number	741709-58-0
Molecular Formula	C13H18BNO3
Molecular Weight	247.09792
MDL Number	MFCD09952047
SMILES	CC(=O)c1nccc(c1)B1OC(C(O1)(C)C)(C)C

1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)ethanone is a versatile compound that finds extensive application in chemical synthesis, particularly in the field of organic chemistry. Due to its unique structural properties, this compound serves as a valuable building block for the synthesis of complex molecules and pharmaceutical intermediates.In organic synthesis, 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)ethanone is commonly employed as a functional group manipulator. Its reactivity allows for the selective modification of other molecules, enabling chemists to introduce specific functionalities at desired positions within a target compound. This controlled functionalization is crucial in the development of new drugs, agrochemicals, and materials with tailored properties.Furthermore, the presence of the boron-containing moiety in 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)ethanone imparts unique characteristics to the molecules into which it is incorporated. Boron-containing compounds often exhibit enhanced stability, reactivity, and selectivity in various chemical reactions, making them valuable tools in modern synthetic chemistry. Therefore, the strategic placement of this compound in a synthetic route can facilitate the efficient construction of complex molecular architectures with defined stereochemistry and functionality.