
Catalog Number	AR005B54
Chemical Name	Isosaccharinic acid-1,4-lactone
CAS Number	7397-89-9
Molecular Formula	C6H10O5
Molecular Weight	162.1406
MDL Number	MFCD18252312
SMILES	OC[C@H]1OC(=O)[C@@](C1)(O)CO

Isosaccharinic acid-1,4-lactone is a versatile compound used in various chemical synthesis processes. It serves as a key intermediate in the production of complex organic molecules due to its unique chemical properties and reactivity. In organic synthesis, Isosaccharinic acid-1,4-lactone can undergo a series of reactions to introduce functional groups, form carbon-carbon bonds, or cyclize to form intricate ring structures. Its ability to participate in Diels-Alder reactions, nucleophilic additions, and ring-opening reactions makes it a valuable building block for the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Additionally, Isosaccharinic acid-1,4-lactone can be utilized in the preparation of chiral compounds through asymmetric synthesis strategies, leading to the creation of enantiomerically pure molecules with high chemical selectivity. Its role in chemical synthesis extends to the development of novel materials, catalysts, and biochemical probes, showcasing its significance in advancing the field of organic chemistry.