
Catalog Number	AR005B6G
Chemical Name	Androstane-11,17-dione,3-hydroxy-, (3a,5b)-
CAS Number	739-27-5
Molecular Formula	C19H28O3
Molecular Weight	304.4238
MDL Number	MFCD00067593
SMILES	OC1CC[C@]2(C(C1)CC[C@@H]1[C@@H]2C(=O)C[C@]2([C@H]1CCC2=O)C)C

11-Ketoetiocholanolone is a valuable chemical compound that finds significant application in chemical synthesis, particularly in the field of steroid and hormone research. Known for its potent metabolic properties, 11-Ketoetiocholanolone serves as a crucial intermediate in the production of various pharmaceuticals and hormone-related substances. Its role in chemical synthesis lies in its ability to serve as a precursor for the preparation of novel steroids and hormonal derivatives, making it a key component in the development of therapeutic agents and performance-enhancing substances. This versatile compound plays a pivotal role in advancing research and innovation within the realm of steroid chemistry and provides a foundation for the creation of new and diverse chemical entities with potential biological activities.