
Catalog Number	AR00ID4K
Chemical Name	2-(Morpholin-4-yl)-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one
CAS Number	736991-86-9
Molecular Formula	C18H26BNO4
Molecular Weight	331.2143
MDL Number	MFCD24039696
SMILES	O=C(c1ccc(cc1)B1OC(C(O1)(C)C)(C)C)CN1CCOCC1

2-(Morpholin-4-yl)-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one is a versatile compound widely used in chemical synthesis. Its unique structure allows it to participate in a variety of reactions, making it a valuable tool in organic chemistry. One common application of this compound is as a building block in the synthesis of complex organic molecules. By incorporating 2-(Morpholin-4-yl)-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one into a reaction mixture, chemists can introduce specific functional groups or stereochemistry into their target compounds. This compound can also serve as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and materials with tailored properties. Its use in chemical synthesis underscores its importance as a crucial component in modern organic chemistry research and development.