
Catalog Number	AR005CTY
Chemical Name	2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride
CAS Number	736173-19-6
Molecular Formula	C18H18ClNO
Molecular Weight	299.7946
SMILES	Cc1ccc(cc1)C(c1ccc2c(c1O)cccc2)N.Cl

2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. With its amino and hydroxyl groups, it can participate in a range of chemical reactions, including but not limited to acylation, alkylation, and condensation reactions. Additionally, the presence of the naphthalene ring provides aromatic stability, making it a valuable scaffold for the construction of more complex molecules. Overall, 2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride is a crucial intermediate in the synthesis of diverse compounds with applications across the chemical industry.