
Catalog Number	AR005NDH
Chemical Name	6-chloro-2-hydroxyquinoline-3-carbaldehyde
CAS Number	73568-44-2
Molecular Formula	C10H6ClNO2
Molecular Weight	207.6131
SMILES	O=Cc1cc2cc(Cl)ccc2[nH]c1=O

6-Chloro-2-oxo-1,2-dihydroquinoline-3-carbaldehyde, also known as $name$, is a versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals due to its unique structural properties and reactivity. In organic synthesis, $name$ is commonly employed as a precursor for the synthesis of diverse heterocyclic compounds, such as quinolines, quinolinones, and related derivatives. Its ability to undergo a variety of reactions, including condensation, cyclization, and functional group transformations, enables the efficient preparation of complex molecular structures. As a valuable intermediate, $name$ plays a crucial role in the development of novel compounds with potential applications in drug discovery, materials science, and other fields of chemical research.