
Catalog Number	AR00FB4F
Chemical Name	1,3-Cyclobutanedicarboxylic acid, 1-amino-, cis-
CAS Number	73550-55-7
Molecular Formula	C6H9NO4
Molecular Weight	159.14
MDL Number	MFCD00153764
SMILES	OC(=O)[C@@H]1C[C@](C1)(N)C(=O)O
NSC Number	621814

Cis-2,4-Methanoglutamate is a versatile compound that finds valuable applications in chemical synthesis. Its unique structure and properties make it a valuable building block in the creation of various organic compounds. In chemical synthesis, cis-2,4-Methanoglutamate serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its presence allows for the stereocontrolled synthesis of complex molecules, enabling chemists to access specific chiral centers and structural motifs with precision. The use of cis-2,4-Methanoglutamate in chemical synthesis enhances reaction selectivity and efficiency, ultimately leading to the creation of high-quality products with diverse applications across industries.