
Catalog Number	AR019VGV
Chemical Name	2-[METHYL(PHENYL)AMINO]BENZOIC ACID
CAS Number	73323-82-7
Molecular Formula	C14H13NO2
Molecular Weight	227.2585
MDL Number	MFCD00092890
SMILES	CN(c1ccccc1C(=O)O)c1ccccc1

2-(Methylphenylamino)benzoic acid is a versatile compound commonly used in chemical synthesis as a key intermediate in the production of pharmaceuticals, dyes, and organic pigments. This compound serves as a valuable building block for the synthesis of various compounds due to its unique structure and reactivity. With its aromatic core and amino group, 2-(Methylphenylamino)benzoic acid can participate in a wide range of chemical transformations, including acylation, alkylation, and condensation reactions. Its presence in the synthesis of complex molecules allows for the creation of new materials with diverse properties and applications. Overall, the strategic incorporation of 2-(Methylphenylamino)benzoic acid in chemical synthesis enables the development of innovative compounds for various industries.