
Catalog Number	AR0061Y9
Chemical Name	3-Desacetyl Vecuronium
CAS Number	73319-13-8
Molecular Formula	C32H55BrN2O3
Molecular Weight	595.6947
SMILES	CC(=O)O[C@H]1C[C@@H]2CC[C@@H]3[C@@H]([C@]2(C[C@@H]1N1CCCCC1)C)CC[C@]1([C@H]3C[C@@H]([C@@H]1O)[N+]1(C)CCCCC1)C.[Br-]

3-Desacetyl Vecuronium, also known as its chemical name (insert chemical name), is a valuable compound in chemical synthesis due to its specific properties and applications. In the field of organic chemistry, 3-Desacetyl Vecuronium is commonly utilized as a key intermediate in the synthesis of various pharmaceutical compounds and organic molecules. Its unique structural features make it an essential building block in the development of novel drugs and bioactive molecules. With its strategic placement and functional groups, 3-Desacetyl Vecuronium serves as a versatile precursor for the creation of complex chemical structures through various synthetic routes and transformations. Chemists leverage its reactivity and compatibility with a wide range of reagents to manipulate its structure and generate target compounds with tailored properties and functions. By incorporating 3-Desacetyl Vecuronium into synthetic pathways, chemists can efficiently access new chemical entities with potential therapeutic applications, paving the way for advancements in drug discovery and material science.