
Catalog Number	AR01FMYR
Chemical Name	4-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2-methoxyphenol
CAS Number	7329-69-3
Molecular Formula	C16H16O4
Molecular Weight	272.2958
MDL Number	MFCD03016326
SMILES	COc1cc(/C=C/c2ccc(c(c2)OC)O)ccc1O

The compound (E)-3,3′-Dimethoxy-4,4′-dihydroxystilbene, is commonly used in chemical synthesis due to its unique properties and reactivity. It serves as a valuable intermediate in the preparation of various organic compounds. In chemical synthesis, (E)-3,3′-Dimethoxy-4,4′-dihydroxystilbene acts as a versatile building block for the construction of more complex molecules through various reactions such as hydroxylation, methylation, or oxidation. Its presence in the synthesis pathway can enable the formation of intricate structures and functional groups, making it an essential component in the creation of pharmaceuticals, agrochemicals, or materials with specific properties. The compound's structural features make it a valuable tool for organic chemists seeking to develop novel compounds with potential applications in diverse fields.