
Catalog Number	AR00FBDX
Chemical Name	5-(4-Fluoro-phenyl)-furan-2-carboxylic acid
CAS Number	73269-32-6
Molecular Formula	C11H7FO3
Molecular Weight	206.1699
MDL Number	MFCD02104577
SMILES	Fc1ccc(cc1)c1ccc(o1)C(=O)O

5-(4-Fluorophenyl)furan-2-carboxylic acid is a versatile compound commonly used in chemical synthesis for its unique properties and applications. Its aromatic ring structure containing a fluorine atom provides enhanced reactivity and selectivity in various reactions compared to its non-fluorinated counterparts. In chemical synthesis, 5-(4-Fluorophenyl)furan-2-carboxylic acid serves as a valuable building block for the preparation of diverse organic compounds. It can be utilized as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Additionally, this compound can participate in cross-coupling reactions, esterifications, and other functional group transformations to facilitate the creation of complex molecular structures. Furthermore, the presence of the furan ring in 5-(4-Fluorophenyl)furan-2-carboxylic acid imparts unique electronic characteristics, enabling its use in the development of materials with specific optical, electronic, or pharmacological properties. Its application extends to the field of medicinal chemistry, where it can be incorporated into drug candidates to modulate their biological activity or improve their pharmacokinetic profile.Overall, 5-(4-Fluorophenyl)furan-2-carboxylic acid plays a crucial role in advancing chemical research and manufacturing processes, offering a versatile platform for the creation of novel compounds with tailored properties and functionalities.