
Catalog Number	AR005D7C
Chemical Name	tert-Butyl (5-fluorothiazol-2-yl)carbamate
CAS Number	731018-54-5
Molecular Formula	C8H11FN2O2S
Molecular Weight	218.2485
MDL Number	MFCD11656630
SMILES	O=C(Nc1ncc(s1)F)OC(C)(C)C

With its unique chemical structure, tert-Butyl (5-fluorothiazol-2-yl)carbamate serves as a valuable reagent in various chemical synthesis processes. This compound is commonly utilized as a building block in the creation of diverse organic molecules due to its ability to participate in a range of key reactions. The incorporation of tert-Butyl (5-fluorothiazol-2-yl)carbamate enables chemists to introduce specific functional groups into target compounds with precision, facilitating the synthesis of complex and tailored chemical structures. Additionally, its presence can impart desired properties or functionalities to the final products, making it a versatile tool in organic chemistry research and development.