
Catalog Number	AR00FB4Q
Chemical Name	2-ATRACTYLENOLIDE
CAS Number	73069-14-4
Molecular Formula	C15H20O2
Molecular Weight	232.3181
MDL Number	MFCD01721423
SMILES	C=C1CCC[C@]2([C@H]1CC1=C(C)C(=O)O[C@H]1C2)C

Atractylenolide II, a natural compound derived from Atractylodes lancea, possesses significant potential in chemical synthesis as a versatile building block. Its unique structure and functional groups make it a valuable reagent for various transformations and reactions in organic synthesis. Atractylenolide II can serve as a precursor for the synthesis of complex molecules and pharmaceutical compounds due to its reactivity and ability to participate in key bond-forming processes. Its application in chemical synthesis enables the creation of novel compounds with diverse properties and potential applications in the fields of medicinal chemistry, materials science, and organic synthesis. Furthermore, the structural features of Atractylenolide II offer opportunities for selective functionalization and modification, making it a valuable asset in the toolkit of synthetic chemists seeking innovative solutions for complex molecule synthesis.