
Catalog Number	AR005D86
Chemical Name	L-Phenylalanine,N-(2-pyrazinylcarbonyl)-, methyl ester
CAS Number	73058-37-4
Molecular Formula	C15H15N3O3
Molecular Weight	285.2979
SMILES	COC(=O)C(NC(=O)c1nccnc1)Cc1ccccc1

The compound 4-(8,9-Dihydropyrido[2,3-b]-1,6-naphthyridin-7(6H)-yl)-4-oxobutanoic acid, often referred to as $name$, plays a crucial role in chemical synthesis, particularly in the formation of complex organic molecules. Its unique structure and functional groups make it a valuable building block for the creation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, $name$ can act as a versatile intermediate that undergoes specific reactions to introduce new functional groups or modify existing ones. Its presence can facilitate the formation of key bonds and help in the construction of intricate molecular scaffolds. Additionally, the oxobutanoic acid moiety in $name$ can serve as a reactive site for further derivatization, enabling the synthesis of diverse compounds with tailored properties.Furthermore, the heterocyclic nature of 4-(8,9-Dihydropyrido[2,3-b]-1,6-naphthyridin-7(6H)-yl) in $name$ imparts specific reactivity and structural features that are desirable in the targeted synthesis of complex organic molecules. This compound's involvement in chemical transformations can lead to the creation of novel compounds with potential applications in various fields of chemistry and beyond.