
Catalog Number	AR00FUJA
Chemical Name	N,N-dimethyl-4-nitrobenzamide
CAS Number	7291-01-2
Molecular Formula	C9H10N2O3
Molecular Weight	194.1873
MDL Number	MFCD00229078
SMILES	CN(C(=O)c1ccc(cc1)[N+](=O)[O-])C
NSC Number	406843

N,N-dimethyl-4-nitrobenzamide, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis for its unique properties. This compound serves as a key building block in the creation of various organic molecules due to its ability to participate in a range of chemical reactions.In chemical synthesis, $name$ is often employed as an intermediate in the preparation of pharmaceutical compounds and agrochemicals. Its structural characteristics make it a valuable precursor for synthesizing more complex molecules with specific functional groups and properties. By strategically incorporating N,N-dimethyl-4-nitrobenzamide into synthetic pathways, chemists can efficiently access diverse derivatives and analogs for various applications.Furthermore, the presence of the nitro group in N,N-dimethyl-4-nitrobenzamide offers opportunities for further functionalization through reduction or substitution reactions. This versatility enables the synthesis of a wide array of compounds with different properties and activities tailored to specific research or industrial needs.Overall, N,N-dimethyl-4-nitrobenzamide plays a crucial role in modern chemical synthesis by enabling the efficient construction of complex organic molecules with tailored functionalities, making it a valuable tool for researchers and practitioners in the field.