
Catalog Number	AR005PDA
Chemical Name	2-amino-3-(4-dimethylaminophenyl)propanoic acid
CAS Number	7284-42-6
Molecular Formula	C11H16N2O2
Molecular Weight	208.2569
MDL Number	MFCD05227987
SMILES	NC(C(=O)O)Cc1ccc(cc1)N(C)C

2-Amino-3-(4-dimethylaminophenyl)propanoic acid, also known as $name$, is a versatile compound commonly utilized in chemical synthesis. This compound plays a crucial role in the creation of various pharmaceuticals, particularly in the development of novel drugs and medications.In chemical synthesis, $name$ is valued for its unique structural properties, which make it ideal for forming key intermediates and functional groups in the creation of complex molecules. By serving as a building block in organic synthesis, this compound enables chemists to efficiently construct intricate chemical structures with precision and control.Moreover, the presence of the amino and phenyl groups in $name$ provides opportunities for functionalization and modification, allowing chemists to tailor the compound to suit specific synthetic requirements. This versatility makes $name$ a valuable asset in the development of new chemical entities and therapeutic agents with diverse biological activities.Overall, the application of 2-Amino-3-(4-dimethylaminophenyl)propanoic acid in chemical synthesis highlights its importance as a key component in the construction of molecules with pharmaceutical relevance, showcasing its significance in the field of organic chemistry and drug discovery.