
Catalog Number	AR00IXSF
Chemical Name	2-[(4-Methylphenoxy)methyl]benzoic acid
CAS Number	728-97-2
Molecular Formula	C15H14O3
Molecular Weight	242.2699
MDL Number	MFCD00963955
SMILES	Cc1ccc(cc1)OCc1ccccc1C(=O)O

2-[(4-methylphenoxy)methyl]benzoic acid is a versatile compound widely employed in chemical synthesis. It serves as a key building block in the production of various pharmaceuticals, agrochemicals, and advanced materials. The unique structure of this compound allows for precise manipulation and modification, making it a valuable tool in the creation of new molecules with specific properties and functions. In organic synthesis, this compound is often used as a starting material for the synthesis of complex chemical compounds due to its reactivity and compatibility with a variety of reaction conditions. Its applications extend to the development of innovative drug candidates, functional materials, and specialty chemicals, highlighting its significance in the field of chemical research and development.