
Catalog Number	AR00FDYZ
Chemical Name	Methyl 2-oxo-2,3-dihydro-1,3-benzoxazole-6-carboxylate
CAS Number	72752-80-8
Molecular Formula	C9H7NO4
Molecular Weight	193.1562
MDL Number	MFCD12827780
SMILES	COC(=O)c1ccc2c(c1)oc(=O)[nH]2

Methyl 2-oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylate, a versatile compound commonly used in chemical synthesis, serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and reactivity make it an indispensable tool in the development of new compounds with potential applications in drug discovery, material science, and chemical industry. With its ability to undergo various synthetic transformations, this compound plays a crucial role in the construction of complex molecular architectures, enabling chemists to access a wide range of novel compounds for further research and development. Its versatility and utility make it a valuable asset in the field of organic chemistry, offering numerous possibilities for the creation of innovative chemical entities with diverse functionalities and applications.