
Catalog Number	AR005G6E
Chemical Name	(S)-Methyl 2-amino-3-(3-methoxyphenyl)propanoate hydrochloride
CAS Number	72747-20-7
Molecular Formula	C11H16ClNO3
Molecular Weight	245.7026
MDL Number	MFCD12911140
SMILES	COC(=O)[C@H](Cc1cccc(c1)OC)N.Cl

(S)-Methyl 2-amino-3-(3-methoxyphenyl)propanoate hydrochloride plays a crucial role in chemical synthesis, particularly in the field of pharmaceuticals and organic chemistry. As a chiral building block, this compound serves as a key intermediate in the creation of enantiopure compounds with precise stereochemistry. Its versatile reactivity allows for the synthesis of complex molecules with high selectivity and efficiency. In asymmetric synthesis, (S)-Methyl 2-amino-3-(3-methoxyphenyl)propanoate hydrochloride is utilized to introduce the desirable chiral properties into target molecules, leading to the production of biologically active compounds and pharmaceutical agents. This compound's strategic placement of functional groups enables the construction of intricate molecular architectures, making it an indispensable tool in the hands of synthetic chemists.