
Catalog Number	AR00ICZ7
Chemical Name	2H-1,3,2-Oxazaphosphorin-2-amine,3-(chloroacetyl)-N-(2-chloroethyl)tetrahydro-, 2-oxide, (R)-
CAS Number	72578-71-3
Molecular Formula	C7H13Cl2N2O3P
Molecular Weight	275.0695
MDL Number	MFCD09952325
SMILES	ClCCN[P@@]1(=O)OCCCN1C(=O)CCl

The compound (R)-2-Chloro-1-(2-((2-chloroethyl)amino)-2-oxido-1,3,2-oxazaphosphinan-3-yl)ethanone is a versatile reagent commonly used in chemical synthesis for the preparation of phosphorus-containing compounds. Its unique structure allows for the introduction of both chloroethylamine and oxazaphosphinane functional groups into a molecule, making it particularly valuable in the synthesis of complex organic compounds. This compound is often employed in the creation of novel pharmaceuticals, agrochemicals, and materials with specific structural and functional properties. Additionally, its chirality as a (R)-enantiomer can play a crucial role in the stereochemistry of the final product, influencing its biological activity and overall performance in various applications.