
Catalog Number	AR00650R
Chemical Name	2-Amino-5-nitropyrimidin-4(1H)-one
CAS Number	7254-29-7
Molecular Formula	C4H4N4O3
Molecular Weight	156.09956
MDL Number	MFCD22495111
SMILES	[O-][N+](=O)c1c[nH]c(nc1=O)N
NSC Number	73278

2-Amino-5-nitropyrimidin-4(1H)-one is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound is commonly employed as a building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo various chemical reactions, such as nucleophilic substitution and reduction, makes it a valuable intermediate in the production of complex organic molecules. Additionally, 2-Amino-5-nitropyrimidin-4(1H)-one can serve as a key starting material for the preparation of heterocyclic compounds, which are important in drug discovery and development. Its significance in organic synthesis lies in its potential to introduce functional groups and structural diversity into target molecules, thus enabling the creation of novel compounds with optimized properties for various applications.