
Catalog Number	AR00FB9D
Chemical Name	3-(4-FLUOROPHENYL)-1-PHENYL-1H-PYRAZOL-5-AMINE
CAS Number	72411-53-1
Molecular Formula	C15H12FN3
Molecular Weight	253.2743
MDL Number	MFCD04122771
SMILES	Fc1ccc(cc1)c1nn(c(c1)N)c1ccccc1

3-(4-Fluorophenyl)-1-phenyl-1H-pyrazol-5-amine is a versatile compound commonly used in chemical synthesis for its unique properties. This particular compound serves as a valuable building block in the creation of various organic molecules and pharmaceuticals due to its structural features. Its aromatic ring structures and amino group make it an ideal starting material for the synthesis of novel compounds with diverse applications in medicinal chemistry and material science. Additionally, the presence of the fluorine atom enhances the compound's reactivity and can impart specific characteristics to the final products. In organic synthesis, 3-(4-Fluorophenyl)-1-phenyl-1H-pyrazol-5-amine is often utilized as a key intermediate for the production of biologically active molecules or functional materials, showcasing its significance in advancing chemical research and development.