
Catalog Number	AR00FBF5
Chemical Name	4-AMINO-3,5-DINITROBENZOIC ACID
CAS Number	7221-27-4
Molecular Formula	C7H5N3O6
Molecular Weight	227.1311
MDL Number	MFCD00017010
SMILES	[O-][N+](=O)c1cc(cc(c1N)[N+](=O)[O-])C(=O)O
NSC Number	127017

4-Amino-3,5-dinitrobenzoic acid is a versatile compound utilized in a variety of chemical synthesis applications. As a key building block in organic chemistry, this compound serves as a precursor in the synthesis of various pharmaceuticals, dyes, and agrochemicals. Its unique chemical structure allows for the creation of complex molecules through diverse synthetic routes. Additionally, 4-Amino-3,5-dinitrobenzoic acid is employed in the production of specialized polymers and as a reagent in the development of novel materials. Its role in chemical synthesis highlights its significance in advancing research and innovation within the realm of organic chemistry.