
Catalog Number	AR00FHLJ
Chemical Name	2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]-
CAS Number	721401-53-2
Molecular Formula	C18H20ClN3O4S
Molecular Weight	409.8871
MDL Number	MFCD26227280
SMILES	O[C@H](CNc1ccc(cc1)N1CCOCC1=O)CNC(=O)c1ccc(s1)Cl

The (R)-5-Chloro-N-(2-hydroxy-3-((4-(3-oxomorpholino)phenyl)amino)propyl)thiophene-2-carboxamide compound serves as a valuable tool in chemical synthesis, particularly in the field of medicinal chemistry. This molecule can be utilized as a key building block in the development of novel pharmaceutical agents due to its unique structural features. Its presence in a synthetic pathway allows for the introduction of specific functionalities and stereochemistry essential for enhancing the biological activity and potency of potential drug candidates. By incorporating this compound into the design of new chemical entities, researchers can explore the diverse reactivity and pharmacological properties that it offers, paving the way for the creation of innovative therapeutic agents.