
Catalog Number	AR005DZX
Chemical Name	Propanediamide,2-ethyl-2-phenyl-
CAS Number	7206-76-0
Molecular Formula	C11H14N2O2
Molecular Weight	206.2411
MDL Number	MFCD00008012
SMILES	CCC(c1ccccc1)(C(=O)N)C(=O)N

2-Ethyl-2-phenylmalonamide is a versatile compound widely used in chemical synthesis as a valuable building block. Its unique structure and properties make it an essential component in various organic reactions, particularly in the formation of complex molecules and pharmaceutical intermediates. This compound is prized for its ability to serve as a key starting material in the synthesis of heterocyclic compounds, which play a crucial role in drug discovery and development. Additionally, 2-Ethyl-2-phenylmalonamide is utilized in the preparation of chiral ligands and catalysts, enabling chemists to perform asymmetric transformations with high levels of efficiency and selectivity. Overall, this compound's versatility and reactivity make it an indispensable tool in modern organic synthesis practices.