
Catalog Number	AR00FLDW
Chemical Name	1,1′-(2,2-Dichloroethylidene)bis[4-chlorobenzene]
CAS Number	72-54-8
Molecular Formula	C14H10Cl4
Molecular Weight	320.0412
MDL Number	MFCD00000851
SMILES	ClC(C(c1ccc(cc1)Cl)c1ccc(cc1)Cl)Cl
NSC Number	8941
UN Number	2761

Derived from DDT, p,p′-DDD is a chlorinated organic compound that finds significant utility in chemical synthesis. Its role as a powerful and versatile building block in organic chemistry is exemplified by its ability to serve as a precursor in the synthesis of various drugs, pesticides, and industrial chemicals. With its strategically placed chloro substituents, p,p′-DDD enables the introduction of functional groups such as amines, alcohols, and acids, enhancing the structural diversity and complexity of the target molecules. Additionally, its relatively simple structure allows for straightforward derivatization and modification, making it a valuable tool for medicinal chemists, agrochemists, and material scientists alike. Through judicious manipulation of its chemical reactivity, p,p′-DDD opens doors to the creation of novel compounds and the exploration of uncharted chemical space.