
Catalog Number	AR00FAY4
Chemical Name	H-D-PHE-NH2 HCL
CAS Number	71666-94-9
Molecular Formula	C9H13ClN2O
Molecular Weight	200.6653
MDL Number	MFCD00153454
SMILES	N[C@@H](C(=O)N)Cc1ccccc1.Cl

H-D-PHE-NH2 HCL, also known as N-Acetyl-L-phenylalanine, is a versatile compound commonly used in chemical synthesis reactions. This compound is widely utilized as a building block for the synthesis of various peptides and proteins due to its ability to introduce phenylalanine residues into peptide sequences. In peptide synthesis, H-D-PHE-NH2 HCL serves as a crucial component for constructing complex peptide structures with specific amino acid sequences. Its unique properties make it a valuable tool in the creation of custom peptides with specific functions and properties tailored to various research and industrial applications. Additionally, H-D-PHE-NH2 HCL can be employed in the development of pharmaceuticals, biomaterials, and biochemical research, highlighting its significance in the field of chemical synthesis.