
Catalog Number	AR00FHMO
Chemical Name	3-(N-isopropylsulfamoyl)benzoic acid
CAS Number	716358-46-2
Molecular Formula	C10H13NO4S
Molecular Weight	243.2795
MDL Number	MFCD05270857
SMILES	CC(NS(=O)(=O)c1cccc(c1)C(=O)O)C

3-(N-Isopropylsulfamoyl)benzoic acid offers a versatile application in chemical synthesis as a key intermediate in the production of various pharmaceutical compounds. This compound serves as a crucial building block that enables the efficient synthesis of diverse molecules with significant biological activities. By incorporating 3-(N-Isopropylsulfamoyl)benzoic acid into synthetic routes, chemists can access a wide range of structurally complex organic molecules, facilitating the development of novel drug candidates and other valuable chemical entities. In the realm of chemical synthesis, this compound plays a pivotal role in enabling the creation of intricate molecular architectures with enhanced functionality and potential therapeutic benefits.