
Catalog Number	AR005IGN
Chemical Name	2-(4-Bromophenyl)succinic acid
CAS Number	71471-40-4
Molecular Formula	C10H9BrO4
Molecular Weight	273.0801
MDL Number	MFCD06656575
SMILES	OC(=O)C(c1ccc(cc1)Br)CC(=O)O

2-(4-Bromophenyl)succinic acid is a versatile compound commonly utilized in chemical synthesis for its unique properties and reactivity. As a derivative of succinic acid, this compound contains a bromophenyl group that imparts specific characteristics ideal for a variety of organic reactions. In chemical synthesis, 2-(4-Bromophenyl)succinic acid serves as a key building block in the creation of numerous organic molecules and pharmaceutical intermediates. Its presence can facilitate the formation of new carbon-carbon and carbon-heteroatom bonds, leading to the synthesis of complex organic structures with tailored properties. Additionally, this compound can act as a precursor for the production of various fine chemicals and materials through strategic functionalization and derivatization processes. Its compatibility with a wide range of synthetic methodologies makes 2-(4-Bromophenyl)succinic acid a valuable tool for chemists seeking to design and develop novel compounds with specific functionalities and applications.