
Catalog Number	AR00FMQ5
Chemical Name	2-[(4-chlorophenyl)carbamoyl]benzoic acid
CAS Number	7142-94-1
Molecular Formula	C14H10ClNO3
Molecular Weight	275.6871
MDL Number	MFCD00029957
SMILES	Clc1ccc(cc1)NC(=O)c1ccccc1C(=O)O
NSC Number	42130

Benzoic acid 2-[[(4-chlorophenyl)amino]carbonyl]- is a versatile compound widely utilized in chemical synthesis due to its diverse applications. The presence of the carbonyl group makes this compound highly reactive and suitable for various synthetic processes. In chemical synthesis, Benzoic acid 2-[[(4-chlorophenyl)amino]carbonyl]- is commonly used as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity allows for the introduction of the 4-chlorophenylamine group into organic molecules, enabling the synthesis of complex compounds with specific properties and functionalities.Additionally, Benzoic acid 2-[[(4-chlorophenyl)amino]carbonyl]- serves as a valuable building block in the creation of advanced materials such as polymers, dyes, and catalysts. Its ability to undergo various chemical transformations opens up opportunities for designing new molecules with tailored properties for a wide range of industrial applications.Overall, the use of Benzoic acid 2-[[(4-chlorophenyl)amino]carbonyl]- in chemical synthesis offers chemists a powerful tool for creating novel substances with enhanced characteristics and potential benefits across different sectors.