
Catalog Number	AR0069D2
Chemical Name	Methyl 5-cyano-6-hydroxy-2-methylnicotinate
CAS Number	71408-02-1
Molecular Formula	C9H8N2O3
Molecular Weight	192.1714
MDL Number	MFCD00793171
SMILES	COC(=O)c1cc(C#N)c(=O)[nH]c1C

The compound Methyl 5-cyano-6-hydroxy-2-methylnicotinate is a versatile building block in chemical synthesis, commonly utilized in the production of various pharmaceuticals, agrochemicals, and materials. With its unique molecular structure, this compound serves as a key intermediate in the synthesis of biologically active compounds and functional materials. Its strategic placement of functional groups allows for selective chemical modifications, enabling the creation of diverse molecular structures with desired properties. In organic synthesis, Methyl 5-cyano-6-hydroxy-2-methylnicotinate plays a crucial role in constructing complex molecules through strategic bond formations and transformations, offering opportunities for the development of new drug candidates, advanced materials, and innovative chemical processes.