
Catalog Number	AR00FD66
Chemical Name	Ethyl (R)-(+)-2-(4-hydroxyphenoxy)propionate
CAS Number	71301-98-9
Molecular Formula	C11H14O4
Molecular Weight	210.2265
MDL Number	MFCD12911580
SMILES	CCOC(=O)[C@H](Oc1ccc(cc1)O)C

Ethyl (2R)-2-(4-hydroxyphenoxy)propanoate is a versatile compound used in the field of chemical synthesis. This compound serves as a key intermediate in the preparation of various organic molecules with valuable applications in pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, Ethyl (2R)-2-(4-hydroxyphenoxy)propanoate plays a crucial role as a building block for the creation of more complex structures. Its unique chemical properties allow for the formation of bonds with different functional groups, enabling the synthesis of diverse compounds with specific properties and functions.Due to its chiral nature, Ethyl (2R)-2-(4-hydroxyphenoxy)propanoate is particularly valuable in the synthesis of enantiomerically pure compounds. This compound can be used as a chiral auxiliary or a starting material for asymmetric synthesis, leading to the production of optically active molecules with high stereochemical control.Overall, Ethyl (2R)-2-(4-hydroxyphenoxy)propanoate is an indispensable tool in the toolbox of synthetic chemists, allowing for the efficient and precise construction of complex organic molecules with a wide range of applications.