
Catalog Number	AR006AQO
Chemical Name	N-BUTYL-3-METHYLPYRIDINIUM DICYANAMIDE
CAS Number	712355-12-9
Molecular Formula	C12H16N4
Molecular Weight	216.2822
MDL Number	MFCD09038878
SMILES	CCCC[n+]1cccc(c1)C.N#C[N-]C#N

N-Butyl-3-methylpyridinium dicyanamide, also known as $name$, is a versatile compound widely used in chemical synthesis processes. This compound functions as a potent phase-transfer catalyst, facilitating the efficient transfer of reactants between immiscible phases during chemical reactions.Its unique structural properties make it particularly well-suited for applications in organic chemistry, where it can promote the formation of various organic compounds through phase-transfer catalysis. The presence of the dicyanamide group enhances its ability to facilitate reactions that involve nucleophilic substitution, such as alkylations and acylations.Furthermore, $name$ has demonstrated excellent stability and performance in a wide range of reaction conditions, making it a valuable tool for synthetic chemists seeking to streamline and optimize their synthetic pathways. Its compatibility with both polar and nonpolar solvents further enhances its utility in a diverse array of chemical transformations.Overall, the application of N-Butyl-3-methylpyridinium dicyanamide as a phase-transfer catalyst underscores its significance in advancing the field of chemical synthesis, offering researchers a reliable and efficient method to drive complex reactions and obtain high yields of desired products.