
Catalog Number	AR003T3Y
Chemical Name	2-(Phenylselanyl)isoindoline-1,3-dione
CAS Number	71098-88-9
Molecular Formula	C14H9NO2Se
Molecular Weight	302.18676
MDL Number	MFCD00010406
SMILES	O=C1N([Se]c2ccccc2)C(=O)c2c1cccc2

2-(Phenylselanyl)isoindoline-1,3-dione is a versatile compound that finds wide application in chemical synthesis. This compound serves as an important building block in organic chemistry, particularly in the formation of complex molecules and pharmaceutical intermediates. Its unique structure containing both a phenylselanyl group and an isoindoline-1,3-dione moiety allows for a variety of synthetic modifications and functionalizations. One of the key applications of 2-(Phenylselanyl)isoindoline-1,3-dione is as a nucleophilic selenium source in organic reactions. The phenylselanyl group can undergo reaction with electrophiles, leading to the selective introduction of the selenium atom into target molecules.Furthermore, the isoindoline-1,3-dione scaffold provides a rigid framework for molecular design, enabling precise control over stereochemistry and conformation in synthetic pathways. This compound is particularly valuable in the synthesis of biologically active molecules and natural products due to its structural features and reactivity profile.In summary, 2-(Phenylselanyl)isoindoline-1,3-dione serves as a powerful tool in organic synthesis, offering a versatile platform for the construction of diverse chemical structures with potential applications in drug discovery, material science, and chemical biology.