
Catalog Number	AR00FCU2
Chemical Name	6-Methoxy-3- quinolinecarboxvlic acid
CAS Number	71082-47-8
Molecular Formula	C11H9NO3
Molecular Weight	203.1941
MDL Number	MFCD08437579
SMILES	COc1ccc2c(c1)cc(cn2)C(=O)O

6-Methoxyquinoline-3-carboxylic acid is a versatile compound that finds wide application in chemical synthesis. As a functionalized quinoline derivative, it serves as a valuable building block for the preparation of various complex organic molecules. In the realm of medicinal chemistry, this compound is often utilized as a key intermediate in the synthesis of pharmaceutical agents and drug candidates.One notable application of 6-Methoxyquinoline-3-carboxylic acid is in the synthesis of heterocyclic compounds, where it can participate in diverse reactions such as cyclization, substitution, and functional group transformations. By incorporating this compound into reaction schemes, chemists can access structurally diverse compounds with unique biological activities.Moreover, 6-Methoxyquinoline-3-carboxylic acid is also employed in the preparation of fluorescent dyes and materials. Its functional groups can be modified to introduce specific properties like solubility, stability, and emission characteristics, making it a valuable component in the development of fluorescent probes and imaging agents for biological studies.Overall, the versatility of 6-Methoxyquinoline-3-carboxylic acid in chemical synthesis makes it an indispensable tool for organic chemists and researchers working in various fields, from drug discovery to materials science.