
Catalog Number	AR00FI58
Chemical Name	1H-Indole-2-carboxylicacid,7-amino-,ethylester(9CI)
CAS Number	71056-61-6
Molecular Formula	C11H12N2O2
Molecular Weight	204.2252
MDL Number	MFCD09863976
SMILES	CCOC(=O)c1cc2c([nH]1)c(N)ccc2

1H-Indole-2-carboxylic acid, 7-amino-, ethyl ester is a highly versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials due to its unique structural properties. Specifically, this compound is employed as a precursor in the synthesis of novel indole-based compounds with diverse applications.In chemical synthesis, 1H-Indole-2-carboxylic acid, 7-amino-, ethyl ester acts as a valuable intermediate in the production of bioactive molecules and drug candidates. Its amino and ester functional groups allow for easy manipulation through various chemical reactions, facilitating the introduction of different substituents to tailor the properties of the final products. Additionally, the indole ring system offers a rich source of chemical reactivity, enabling the formation of complex molecular architectures with potentially beneficial properties.Overall, the strategic incorporation of 1H-Indole-2-carboxylic acid, 7-amino-, ethyl ester in chemical synthesis processes empowers chemists to access a diverse array of compounds with vast applications in the fields of medicine, agriculture, and materials science.