
Catalog Number	AR00FCY6
Chemical Name	(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide hydrochloride
CAS Number	709031-39-0
Molecular Formula	C6H11ClN2O
Molecular Weight	162.6173
MDL Number	MFCD13151930
SMILES	NC(=O)[C@@H]1C[C@H]2[C@@H](N1)C2.Cl

(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide hydrochloride is a valuable compound frequently utilized in chemical synthesis as a versatile building block for creating various organic molecules. Its unique structure and reactivity make it an attractive reagent for the development of complex chemical structures in a controlled and efficient manner.In chemical synthesis, (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide hydrochloride can serve as a chiral scaffold, allowing for the introduction of stereochemical diversity into target molecules. Its three-dimensional arrangement provides a rigid framework for the spatial arrangement of functional groups, leading to the formation of enantiopure compounds with defined stereochemistry.Additionally, this compound can act as a nucleophile or electrophile in various reactions, enabling the construction of carbon-carbon and carbon-nitrogen bonds in the synthesis of complex organic molecules. Its cyclic structure imparts stability and selectivity to the reactions, facilitating the formation of specific regioisomers and stereoisomers with high efficiency.Furthermore, (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide hydrochloride can participate in tandem reactions, where multiple chemical transformations occur sequentially to streamline the synthesis of intricate molecular architectures. Its use in cascade reactions enhances the synthetic efficiency and overall yield of the desired products.Overall, the application of (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide hydrochloride in chemical synthesis highlights its significance as a key reagent for the construction of complex organic molecules with defined stereochemistry and structural motifs.