
Catalog Number	AR005GDJ
Chemical Name	2-Propenoic acid, 3-(3,4,5-trihydroxyphenyl)-, (2E)-
CAS Number	709007-50-1
Molecular Formula	C9H8O5
Molecular Weight	196.15681999999995
MDL Number	MFCD03002818
SMILES	OC(=O)/C=C/c1cc(O)c(c(c1)O)O

The 2-Propenoic acid, 3-(3,4,5-trihydroxyphenyl)-, (2E)- is a valuable compound in chemical synthesis due to its versatile applications. It serves as a key component in the formulation of various pharmaceuticals, cosmetics, and food products. This compound is frequently utilized as a building block in the synthesis of organic molecules with biological activity, making it a crucial intermediate in the production of drugs and other biologically active substances. Its reactivity and structural properties make it a highly sought-after ingredient in the field of organic chemistry, where its incorporation into complex molecules can lead to the development of novel materials and compounds. Additionally, the presence of the trihydroxyphenyl group in the compound provides opportunities for the creation of bioactive compounds that can potentially have therapeutic effects. The unique structure and reactivity of 2-Propenoic acid, 3-(3,4,5-trihydroxyphenyl)-, (2E)- make it an indispensable tool for chemical synthesis, enabling the creation of a wide range of functional molecules with diverse applications.