
Catalog Number	AR00FGCD
Chemical Name	4'-Bromo-2-nitro-biphenyl
CAS Number	70873-41-5
Molecular Formula	C12H8BrNO2
Molecular Weight	278.1014
MDL Number	MFCD18906612
SMILES	Brc1ccc(c(c1)[N+](=O)[O-])c1ccccc1

4-Bromo-2-nitro-biphenyl, also known as 4-Br-2-NO2-C6H4-C6H4, is a versatile chemical compound commonly used in organic synthesis. This compound is widely utilized as a key building block in the production of various pharmaceuticals, agrochemicals, and fine chemicals.In chemical synthesis, 4-Bromo-2-nitro-biphenyl serves as a crucial intermediate for the synthesis of more complex molecules. Its unique structure and reactivity make it valuable for introducing specific functional groups into target compounds. The bromo and nitro groups on the biphenyl ring provide important points for further derivatization, allowing chemists to modify the compound according to desired properties.One of the primary applications of 4-Bromo-2-nitro-biphenyl is in the synthesis of biologically active molecules. By strategically modifying this compound through various synthetic reactions, researchers can access a wide range of pharmacophores with potential therapeutic applications. Additionally, the presence of the bromo and nitro groups enables chemists to conduct further transformations such as Suzuki coupling, Buchwald-Hartwig amination, and metal-catalyzed cross-coupling reactions.Overall, 4-Bromo-2-nitro-biphenyl plays a crucial role in the realm of chemical synthesis, empowering chemists to design and construct intricate molecules with diverse functionalities for applications in various industries.