
Catalog Number	AR00FHTR
Chemical Name	1-Pyrrolidinecarboxylicacid,4-amino-2-methyl-,1,1-dimethylethylester,(2S,4R)-(9CI)
CAS Number	708274-46-8
Molecular Formula	C10H20N2O2
Molecular Weight	200.2780
MDL Number	MFCD19687844
SMILES	C[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)N

The tert-butyl (2S,4R)-4-amino-2-methylpyrrolidine-1-carboxylate compound plays a crucial role in chemical synthesis as a versatile building block. Its unique structure enables its utilization in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. By serving as a key intermediate, this compound contributes to the creation of intricate organic molecules with specific stereochemical properties. Its application extends to the development of novel drug candidates, complex organic materials, and bioactive compounds, highlighting its significance in advancing the field of organic chemistry.