
Catalog Number	AR00FFG0
Chemical Name	2-(N-(5-Chloro-2-methylphenyl)methylsulfonamido)-N-(2,6-difluorophenyl)acetamide
CAS Number	708219-39-0
Molecular Formula	C16H15ClF2N2O3S
Molecular Weight	388.8167
MDL Number	MFCD04376899
SMILES	O=C(CN(S(=O)(=O)C)c1cc(Cl)ccc1C)Nc1c(F)cccc1F

FPH1 (BRD-6125) is a potent and selective inhibitor that has found valuable applications in chemical synthesis. With its unique chemical structure and properties, FPH1 plays a crucial role in the field of medicinal chemistry. This compound has been extensively utilized for its ability to target and modulate specific enzymes and pathways involved in various synthetic processes. By inhibiting key molecular targets, FPH1 facilitates the controlled manipulation of chemical reactions, enabling researchers to efficiently synthesize complex molecules with high precision and accuracy. The use of FPH1 in chemical synthesis has led to significant advancements in drug discovery, organic chemistry, and materials science.