
Catalog Number	AR00ICSK
Chemical Name	2(1H)-Pyrimidinone, 4-amino-1-(5-O-phosphono-b-D-arabinofuranosyl)-
CAS Number	7075-11-8
Molecular Formula	C9H14N3O8P
Molecular Weight	323.1965
MDL Number	MFCD00069771
SMILES	O[C@H]1[C@H](O)[C@H](O[C@H]1n1ccc(nc1=O)N)COP(=O)(O)O

The compound ((2R,3S,4S,5R)-5-(4-Amino-2-oxopyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate is utilized in chemical synthesis as a versatile building block. It serves as an essential component in the construction of nucleic acid analogs and prodrugs due to its ability to act as a phosphorylating agent. This compound plays a crucial role in the creation of nucleotide derivatives through phosphoramidite chemistry, enabling the incorporation of modified nucleotides into oligonucleotide sequences. Its unique structure and reactivity make it a valuable tool in the development of novel pharmaceuticals, gene therapy agents, and bioconjugates.