
Catalog Number	AR00ICSF
Chemical Name	Carbamic acid, [(1R)-1-(aminocarbonyl)-2-methylpropyl]-,1,1-dimethylethyl ester
CAS Number	70717-76-9
Molecular Formula	C10H20N2O3
Molecular Weight	216.2774
MDL Number	MFCD09027060
SMILES	O=C(OC(C)(C)C)N[C@@H](C(=O)N)C(C)C

The (R)-tert-Butyl (1-amino-3-methyl-1-oxobutan-2-yl)carbamate, also known as $name$, is a versatile compound commonly used in chemical synthesis processes. Its unique structure and properties make it a valuable building block for various reactions in organic chemistry. In chemical synthesis, this compound serves as a key intermediate for the preparation of important molecules, such as pharmaceuticals, agrochemicals, and advanced materials. Its presence enables the synthesis of complex structures with high stereochemical control, making it a valuable tool for researchers and chemists working in the field.